C26H35NO6 — CID 157342055
2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol;(E)-3-formyloxyprop-2-enoic acid (PubChem CID 157342055) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is 2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol;(E)-3-formyloxyprop-2-enoic acid.
| Compound Name | 2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol;(E)-3-formyloxyprop-2-enoic acid |
|---|---|
| PubChem CID | 157342055 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol;(E)-3-formyloxyprop-2-enoic acid |
| SMILES | CC(C)N(CC[C@H](c1ccccc1)c1cc(CO)ccc1O)C(C)C.O=CO/C=C/C(=O)O |
| InChI | InChI=1S/C22H31NO2.C4H4O4/c1-16(2)23(17(3)4)13-12-20(19-8-6-5-7-9-19)21-14-18(15-24)10-11-22(21)25;5-3-8-2-1-4(6)7/h5-11,14,16-17,20,24-25H,12-13,15H2,1-4H3;1-3H,(H,6,7)/b;2-1+/t20-;/m1./s1 |
| InChIKey | BGMYNCWWBGEXKW-BOQYJDHWSA-N |
| XLogP | 4.28 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|