C33H41NO6 — CID 71258122
but-2-enedioic acid;[3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-phenylmethoxyphenyl]methanol (PubChem CID 71258122) has the molecular formula C33H41NO6 and a molecular weight of 547.69 g/mol. Its IUPAC name is but-2-enedioic acid;[3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-phenylmethoxyphenyl]methanol.
| Compound Name | but-2-enedioic acid;[3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-phenylmethoxyphenyl]methanol |
|---|---|
| PubChem CID | 71258122 |
| Molecular Formula | C33H41NO6 |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | but-2-enedioic acid;[3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-phenylmethoxyphenyl]methanol |
| SMILES | CC(C)N(CC[C@H](c1ccccc1)c1cc(CO)ccc1OCc1ccccc1)C(C)C.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C29H37NO2.C4H4O4/c1-22(2)30(23(3)4)18-17-27(26-13-9-6-10-14-26)28-19-25(20-31)15-16-29(28)32-21-24-11-7-5-8-12-24;5-3(6)1-2-4(7)8/h5-16,19,22-23,27,31H,17-18,20-21H2,1-4H3;1-2H,(H,5,6)(H,7,8)/t27-;/m1./s1 |
| InChIKey | KGYDIDIJCLRAQM-HZPIKELBSA-N |
| XLogP | 6.11 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|