C30H41NO7 — CID 157314540
carbon dioxide;[2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenyl] 2-methylpropanoate;prop-2-enoic acid (PubChem CID 157314540) has the molecular formula C30H41NO7 and a molecular weight of 527.66 g/mol. Its IUPAC name is carbon dioxide;[2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenyl] 2-methylpropanoate;prop-2-enoic acid.
| Compound Name | carbon dioxide;[2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenyl] 2-methylpropanoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 157314540 |
| Molecular Formula | C30H41NO7 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | carbon dioxide;[2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenyl] 2-methylpropanoate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CC(C)C(=O)Oc1ccc(CO)cc1[C@H](CCN(C(C)C)C(C)C)c1ccccc1.O=C=O |
| InChI | InChI=1S/C26H37NO3.C3H4O2.CO2/c1-18(2)26(29)30-25-13-12-21(17-28)16-24(25)23(22-10-8-7-9-11-22)14-15-27(19(3)4)20(5)6;1-2-3(4)5;2-1-3/h7-13,16,18-20,23,28H,14-15,17H2,1-6H3;2H,1H2,(H,4,5);/t23-;;/m1../s1 |
| InChIKey | BDKZGOSVXKYJFJ-MQWQBNKOSA-N |
| XLogP | 5.05 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|