C36H40ClNO4 — CID 159684512
[4-benzoyloxy-3-[3-[di(propan-2-yl)amino]-1-phenylpropyl]phenyl]methyl benzoate;hydrochloride (PubChem CID 159684512) has the molecular formula C36H40ClNO4 and a molecular weight of 586.17 g/mol. Its IUPAC name is [4-benzoyloxy-3-[3-[di(propan-2-yl)amino]-1-phenylpropyl]phenyl]methyl benzoate;hydrochloride.
| Compound Name | [4-benzoyloxy-3-[3-[di(propan-2-yl)amino]-1-phenylpropyl]phenyl]methyl benzoate;hydrochloride |
|---|---|
| PubChem CID | 159684512 |
| Molecular Formula | C36H40ClNO4 |
| Molecular Weight | 586.17 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | [4-benzoyloxy-3-[3-[di(propan-2-yl)amino]-1-phenylpropyl]phenyl]methyl benzoate;hydrochloride |
| SMILES | CC(C)N(CCC(c1ccccc1)c1cc(COC(=O)c2ccccc2)ccc1OC(=O)c1ccccc1)C(C)C.Cl |
| InChI | InChI=1S/C36H39NO4.ClH/c1-26(2)37(27(3)4)23-22-32(29-14-8-5-9-15-29)33-24-28(25-40-35(38)30-16-10-6-11-17-30)20-21-34(33)41-36(39)31-18-12-7-13-19-31;/h5-21,24,26-27,32H,22-23,25H2,1-4H3;1H |
| InChIKey | MVPRSMZXCVUEDX-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.17 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|