C31H39NO3 — CID 151257385
[3-[5-[di(propan-2-yl)amino]-1-phenylpentyl]-4-hydroxyphenyl]methyl benzoate (PubChem CID 151257385) has the molecular formula C31H39NO3 and a molecular weight of 473.66 g/mol. Its IUPAC name is [3-[5-[di(propan-2-yl)amino]-1-phenylpentyl]-4-hydroxyphenyl]methyl benzoate.
| Compound Name | [3-[5-[di(propan-2-yl)amino]-1-phenylpentyl]-4-hydroxyphenyl]methyl benzoate |
|---|---|
| PubChem CID | 151257385 |
| Molecular Formula | C31H39NO3 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | [3-[5-[di(propan-2-yl)amino]-1-phenylpentyl]-4-hydroxyphenyl]methyl benzoate |
| SMILES | CC(C)N(CCCCC(c1ccccc1)c1cc(COC(=O)c2ccccc2)ccc1O)C(C)C |
| InChI | InChI=1S/C31H39NO3/c1-23(2)32(24(3)4)20-12-11-17-28(26-13-7-5-8-14-26)29-21-25(18-19-30(29)33)22-35-31(34)27-15-9-6-10-16-27/h5-10,13-16,18-19,21,23-24,28,33H,11-12,17,20,22H2,1-4H3 |
| InChIKey | NTPQAOJRSQQJSZ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|