C25H35NO2 — CID 130303258
[3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-prop-2-enoxyphenyl]methanol (PubChem CID 130303258) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is [3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-prop-2-enoxyphenyl]methanol.
| Compound Name | [3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-prop-2-enoxyphenyl]methanol |
|---|---|
| PubChem CID | 130303258 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | [3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-prop-2-enoxyphenyl]methanol |
| SMILES | C=CCOc1ccc(CO)cc1[C@H](CCN(C(C)C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H35NO2/c1-6-16-28-25-13-12-21(18-27)17-24(25)23(22-10-8-7-9-11-22)14-15-26(19(2)3)20(4)5/h6-13,17,19-20,23,27H,1,14-16,18H2,2-5H3/t23-/m1/s1 |
| InChIKey | ZDKDYGIBCFJMEV-HSZRJFAPSA-N |
| XLogP | 5.38 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|