C21H29ClN4O — CID 18357406
4-azido-2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]phenol;hydrochloride (PubChem CID 18357406) has the molecular formula C21H29ClN4O and a molecular weight of 388.94 g/mol. Its IUPAC name is 4-azido-2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]phenol;hydrochloride.
| Compound Name | 4-azido-2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 18357406 |
| Molecular Formula | C21H29ClN4O |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 4-azido-2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]phenol;hydrochloride |
| SMILES | CC(C)N(CCC(c1ccccc1)c1cc(N=[N+]=[N-])ccc1O)C(C)C.Cl |
| InChI | InChI=1S/C21H28N4O.ClH/c1-15(2)25(16(3)4)13-12-19(17-8-6-5-7-9-17)20-14-18(23-24-22)10-11-21(20)26;/h5-11,14-16,19,26H,12-13H2,1-4H3;1H |
| InChIKey | QLTIKURIPRNYLZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|