C22H31NO — CID 54021285
[2-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]phenyl]methanol (PubChem CID 54021285) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is [2-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]phenyl]methanol.
| Compound Name | [2-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]phenyl]methanol |
|---|---|
| PubChem CID | 54021285 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | [2-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]phenyl]methanol |
| SMILES | CC(C)N(CC[C@@H](c1ccccc1)c1ccccc1CO)C(C)C |
| InChI | InChI=1S/C22H31NO/c1-17(2)23(18(3)4)15-14-22(19-10-6-5-7-11-19)21-13-9-8-12-20(21)16-24/h5-13,17-18,22,24H,14-16H2,1-4H3/t22-/m0/s1 |
| InChIKey | KZCHNXOBHXLNMG-QFIPXVFZSA-N |
| XLogP | 4.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |