C20H29NOS — CID 54331885
[2-[3-[di(propan-2-yl)amino]-1-thiophen-2-ylpropyl]phenyl]methanol (PubChem CID 54331885) has the molecular formula C20H29NOS and a molecular weight of 331.53 g/mol. Its IUPAC name is [2-[3-[di(propan-2-yl)amino]-1-thiophen-2-ylpropyl]phenyl]methanol.
| Compound Name | [2-[3-[di(propan-2-yl)amino]-1-thiophen-2-ylpropyl]phenyl]methanol |
|---|---|
| PubChem CID | 54331885 |
| Molecular Formula | C20H29NOS |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | [2-[3-[di(propan-2-yl)amino]-1-thiophen-2-ylpropyl]phenyl]methanol |
| SMILES | CC(C)N(CCC(c1cccs1)c1ccccc1CO)C(C)C |
| InChI | InChI=1S/C20H29NOS/c1-15(2)21(16(3)4)12-11-19(20-10-7-13-23-20)18-9-6-5-8-17(18)14-22/h5-10,13,15-16,19,22H,11-12,14H2,1-4H3 |
| InChIKey | SYXHYQHEKPUAFT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |