About ethane;phenol;2-propan-2-ylthiophene
ethane;phenol;2-propan-2-ylthiophene (PubChem CID 161233504) has the molecular formula C21H28O2S
and a molecular weight of 344.52 g/mol. Its IUPAC name is ethane;phenol;2-propan-2-ylthiophene.
Molecular Properties
| Compound Name | ethane;phenol;2-propan-2-ylthiophene |
| PubChem CID | 161233504 |
| Molecular Formula | C21H28O2S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | ethane;phenol;2-propan-2-ylthiophene |
| SMILES | CC.CC(C)c1cccs1.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C7H10S.2C6H6O.C2H6/c1-6(2)7-4-3-5-8-7;2*7-6-4-2-1-3-5-6;1-2/h3-6H,1-2H3;2*1-5,7H;1-2H3 |
| InChIKey | UZBKEQXOSYEHAZ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;phenol;2-propan-2-ylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;phenol;2-propan-2-ylthiophene?
The IUPAC name of ethane;phenol;2-propan-2-ylthiophene (CID 161233504) is ethane;phenol;2-propan-2-ylthiophene.
What is the SMILES notation for ethane;phenol;2-propan-2-ylthiophene?
The canonical SMILES for ethane;phenol;2-propan-2-ylthiophene is CC.CC(C)c1cccs1.Oc1ccccc1.Oc1ccccc1.
What is the InChIKey of ethane;phenol;2-propan-2-ylthiophene?
The InChIKey is UZBKEQXOSYEHAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10S.2C6H6O.C2H6/c1-6(2)7-4-3-5-8-7;2*7-6-4-2-1-3-5-6;1-2/h3-6H,1-2H3;2*1-5,7H;1-2H3.
What are the key properties of ethane;phenol;2-propan-2-ylthiophene?
ethane;phenol;2-propan-2-ylthiophene has a molecular weight of 344.52 g/mol, XLogP of 6.68, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;phenol;2-propan-2-ylthiophene is sourced from PubChem (CID 161233504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).