C33H41NO5 — CID 142655408
[2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxy-3-methylphenyl] 4-(2-methylpropanoyloxy)benzoate (PubChem CID 142655408) has the molecular formula C33H41NO5 and a molecular weight of 531.69 g/mol. Its IUPAC name is [2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxy-3-methylphenyl] 4-(2-methylpropanoyloxy)benzoate.
| Compound Name | [2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxy-3-methylphenyl] 4-(2-methylpropanoyloxy)benzoate |
|---|---|
| PubChem CID | 142655408 |
| Molecular Formula | C33H41NO5 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | [2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxy-3-methylphenyl] 4-(2-methylpropanoyloxy)benzoate |
| SMILES | Cc1c(O)ccc(OC(=O)c2ccc(OC(=O)C(C)C)cc2)c1[C@H](CCN(C(C)C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C33H41NO5/c1-21(2)32(36)38-27-15-13-26(14-16-27)33(37)39-30-18-17-29(35)24(7)31(30)28(25-11-9-8-10-12-25)19-20-34(22(3)4)23(5)6/h8-18,21-23,28,35H,19-20H2,1-7H3/t28-/m1/s1 |
| InChIKey | JVPPGFCMGNJWJJ-MUUNZHRXSA-N |
| XLogP | 7.12 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|