C28H33NO6 — CID 139804751
6-(4-methoxyphenyl)-N-(2-methoxypropan-2-yloxy)-6-(3-methyl-1,4-dioxonaphthalen-2-yl)hexanamide (PubChem CID 139804751) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-N-(2-methoxypropan-2-yloxy)-6-(3-methyl-1,4-dioxonaphthalen-2-yl)hexanamide.
| Compound Name | 6-(4-methoxyphenyl)-N-(2-methoxypropan-2-yloxy)-6-(3-methyl-1,4-dioxonaphthalen-2-yl)hexanamide |
|---|---|
| PubChem CID | 139804751 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 6-(4-methoxyphenyl)-N-(2-methoxypropan-2-yloxy)-6-(3-methyl-1,4-dioxonaphthalen-2-yl)hexanamide |
| SMILES | COc1ccc(C(CCCCC(=O)NOC(C)(C)OC)C2=C(C)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C28H33NO6/c1-18-25(27(32)23-12-7-6-11-22(23)26(18)31)21(19-14-16-20(33-4)17-15-19)10-8-9-13-24(30)29-35-28(2,3)34-5/h6-7,11-12,14-17,21H,8-10,13H2,1-5H3,(H,29,30) |
| InChIKey | YSSVLDFFGJLKRD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|