C17H19NO4 — CID 57246344
N-hydroxy-3,3-bis(4-methoxyphenyl)propanamide (PubChem CID 57246344) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is N-hydroxy-3,3-bis(4-methoxyphenyl)propanamide.
| Compound Name | N-hydroxy-3,3-bis(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 57246344 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-hydroxy-3,3-bis(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(C(CC(=O)NO)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C17H19NO4/c1-21-14-7-3-12(4-8-14)16(11-17(19)18-20)13-5-9-15(22-2)10-6-13/h3-10,16,20H,11H2,1-2H3,(H,18,19) |
| InChIKey | VIUJDZQSOKDGDO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|