C21H25NO4S — CID 97280000
(3R)-N-(1,1-dioxothian-4-yl)-3-(4-methoxyphenyl)-3-phenylpropanamide (PubChem CID 97280000) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is (3R)-N-(1,1-dioxothian-4-yl)-3-(4-methoxyphenyl)-3-phenylpropanamide.
| Compound Name | (3R)-N-(1,1-dioxothian-4-yl)-3-(4-methoxyphenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 97280000 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (3R)-N-(1,1-dioxothian-4-yl)-3-(4-methoxyphenyl)-3-phenylpropanamide |
| SMILES | COc1ccc([C@H](CC(=O)NC2CCS(=O)(=O)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NO4S/c1-26-19-9-7-17(8-10-19)20(16-5-3-2-4-6-16)15-21(23)22-18-11-13-27(24,25)14-12-18/h2-10,18,20H,11-15H2,1H3,(H,22,23)/t20-/m1/s1 |
| InChIKey | KDYJKHMEAALINM-HXUWFJFHSA-N |
| XLogP | 2.91 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |