C27H34ClNO4 — CID 159124710
(2S)-1-amino-7,7-bis(4-methoxyphenyl)-1-phenoxyheptan-2-ol;hydrochloride (PubChem CID 159124710) has the molecular formula C27H34ClNO4 and a molecular weight of 472.03 g/mol. Its IUPAC name is (2S)-1-amino-7,7-bis(4-methoxyphenyl)-1-phenoxyheptan-2-ol;hydrochloride.
| Compound Name | (2S)-1-amino-7,7-bis(4-methoxyphenyl)-1-phenoxyheptan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 159124710 |
| Molecular Formula | C27H34ClNO4 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | (2S)-1-amino-7,7-bis(4-methoxyphenyl)-1-phenoxyheptan-2-ol;hydrochloride |
| SMILES | COc1ccc(C(CCCC[C@H](O)C(N)Oc2ccccc2)c2ccc(OC)cc2)cc1.Cl |
| InChI | InChI=1S/C27H33NO4.ClH/c1-30-22-16-12-20(13-17-22)25(21-14-18-23(31-2)19-15-21)10-6-7-11-26(29)27(28)32-24-8-4-3-5-9-24;/h3-5,8-9,12-19,25-27,29H,6-7,10-11,28H2,1-2H3;1H/t26-,27?;/m0./s1 |
| InChIKey | BSBMQUIZFKGULY-DDXKXVGSSA-N |
| XLogP | 5.54 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|