C19H26N2O2 — CID 20520919
1-amino-5-(2,6-dimethylanilino)-1-phenoxypentan-2-ol (PubChem CID 20520919) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-amino-5-(2,6-dimethylanilino)-1-phenoxypentan-2-ol.
| Compound Name | 1-amino-5-(2,6-dimethylanilino)-1-phenoxypentan-2-ol |
|---|---|
| PubChem CID | 20520919 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-amino-5-(2,6-dimethylanilino)-1-phenoxypentan-2-ol |
| SMILES | Cc1cccc(C)c1NCCCC(O)C(N)Oc1ccccc1 |
| InChI | InChI=1S/C19H26N2O2/c1-14-8-6-9-15(2)18(14)21-13-7-12-17(22)19(20)23-16-10-4-3-5-11-16/h3-6,8-11,17,19,21-22H,7,12-13,20H2,1-2H3 |
| InChIKey | VURSLEGHYPGDCG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|