C18H30N2O4 — CID 141067649
[(2S)-5-(2,6-dimethylanilino)-1-hydroxypentan-2-yl]-[(2-methylpropan-2-yl)oxy]carbamic acid (PubChem CID 141067649) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is [(2S)-5-(2,6-dimethylanilino)-1-hydroxypentan-2-yl]-[(2-methylpropan-2-yl)oxy]carbamic acid.
| Compound Name | [(2S)-5-(2,6-dimethylanilino)-1-hydroxypentan-2-yl]-[(2-methylpropan-2-yl)oxy]carbamic acid |
|---|---|
| PubChem CID | 141067649 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | [(2S)-5-(2,6-dimethylanilino)-1-hydroxypentan-2-yl]-[(2-methylpropan-2-yl)oxy]carbamic acid |
| SMILES | Cc1cccc(C)c1NCCC[C@@H](CO)N(OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C18H30N2O4/c1-13-8-6-9-14(2)16(13)19-11-7-10-15(12-21)20(17(22)23)24-18(3,4)5/h6,8-9,15,19,21H,7,10-12H2,1-5H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | VVVUXHHEQSELFK-HNNXBMFYSA-N |
| XLogP | 3.57 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|