C20H33NO5 — CID 70621900
2,6-dimethyl-N-octylaniline;2-hydroxybutanedioic acid (PubChem CID 70621900) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is 2,6-dimethyl-N-octylaniline;2-hydroxybutanedioic acid.
| Compound Name | 2,6-dimethyl-N-octylaniline;2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 70621900 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 2,6-dimethyl-N-octylaniline;2-hydroxybutanedioic acid |
| SMILES | CCCCCCCCNc1c(C)cccc1C.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C16H27N.C4H6O5/c1-4-5-6-7-8-9-13-17-16-14(2)11-10-12-15(16)3;5-2(4(8)9)1-3(6)7/h10-12,17H,4-9,13H2,1-3H3;2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | WUUZXCFIVJSXSG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|