C13H19NO2 — CID 175538746
5-(2,6-dimethylanilino)-4-hydroxypentan-2-one (PubChem CID 175538746) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 5-(2,6-dimethylanilino)-4-hydroxypentan-2-one.
| Compound Name | 5-(2,6-dimethylanilino)-4-hydroxypentan-2-one |
|---|---|
| PubChem CID | 175538746 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 5-(2,6-dimethylanilino)-4-hydroxypentan-2-one |
| SMILES | CC(=O)CC(O)CNc1c(C)cccc1C |
| InChI | InChI=1S/C13H19NO2/c1-9-5-4-6-10(2)13(9)14-8-12(16)7-11(3)15/h4-6,12,14,16H,7-8H2,1-3H3 |
| InChIKey | IIUQCVGFHAWLFF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |