C15H25NO2 — CID 55061574
1-(2,6-dimethylanilino)-3-(2-methylpropoxy)propan-2-ol (PubChem CID 55061574) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-(2,6-dimethylanilino)-3-(2-methylpropoxy)propan-2-ol.
| Compound Name | 1-(2,6-dimethylanilino)-3-(2-methylpropoxy)propan-2-ol |
|---|---|
| PubChem CID | 55061574 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-(2,6-dimethylanilino)-3-(2-methylpropoxy)propan-2-ol |
| SMILES | Cc1cccc(C)c1NCC(O)COCC(C)C |
| InChI | InChI=1S/C15H25NO2/c1-11(2)9-18-10-14(17)8-16-15-12(3)6-5-7-13(15)4/h5-7,11,14,16-17H,8-10H2,1-4H3 |
| InChIKey | FLLXFTUAVZUTIN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |