C20H39NO7 — CID 174596527
2-[dodecyl(methyl)amino]propanoic acid;2-hydroxybutanedioic acid (PubChem CID 174596527) has the molecular formula C20H39NO7 and a molecular weight of 405.53 g/mol. Its IUPAC name is 2-[dodecyl(methyl)amino]propanoic acid;2-hydroxybutanedioic acid.
| Compound Name | 2-[dodecyl(methyl)amino]propanoic acid;2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 174596527 |
| Molecular Formula | C20H39NO7 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 2-[dodecyl(methyl)amino]propanoic acid;2-hydroxybutanedioic acid |
| SMILES | CCCCCCCCCCCCN(C)C(C)C(=O)O.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C16H33NO2.C4H6O5/c1-4-5-6-7-8-9-10-11-12-13-14-17(3)15(2)16(18)19;5-2(4(8)9)1-3(6)7/h15H,4-14H2,1-3H3,(H,18,19);2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | VDJRERNVZGQJKY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|