(2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid

C17H35NO2 — CID 154125332

IUPAC(2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid
SMILESCCCCCCCCCCCN(C)[C@@H](C(=O)O)C(C)C
InChIInChI=1S/C17H35NO2/c1-5-6-7-8-9-10-11-12-13-14-18(4)16(15(2)3)17(19)20/h15-16H,5-14H2,1-4H3,(H,19,20)/t16-/m1/s1
InChIKeyLHSDGSQGOZNHAT-MRXNPFEDSA-N
MW285.47 g/mol
LogP4.56
Rot. Bonds13

About (2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid

(2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid (PubChem CID 154125332) has the molecular formula C17H35NO2 and a molecular weight of 285.47 g/mol. Its IUPAC name is (2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid.

Molecular Properties

Compound Name(2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid
PubChem CID154125332
Molecular FormulaC17H35NO2
Molecular Weight285.47 g/mol
Exact Mass285.27
IUPAC Name(2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid
SMILESCCCCCCCCCCCN(C)[C@@H](C(=O)O)C(C)C
InChIInChI=1S/C17H35NO2/c1-5-6-7-8-9-10-11-12-13-14-18(4)16(15(2)3)17(19)20/h15-16H,5-14H2,1-4H3,(H,19,20)/t16-/m1/s1
InChIKeyLHSDGSQGOZNHAT-MRXNPFEDSA-N
XLogP4.56
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds13
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.47
LogP ≤ 54.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid?
The IUPAC name of (2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid (CID 154125332) is (2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid.
What is the SMILES notation for (2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid?
The canonical SMILES for (2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid is CCCCCCCCCCCN(C)[C@@H](C(=O)O)C(C)C.
What is the InChIKey of (2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid?
The InChIKey is LHSDGSQGOZNHAT-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H35NO2/c1-5-6-7-8-9-10-11-12-13-14-18(4)16(15(2)3)17(19)20/h15-16H,5-14H2,1-4H3,(H,19,20)/t16-/m1/s1.
What are the key properties of (2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid?
(2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid has a molecular weight of 285.47 g/mol, XLogP of 4.56, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-methyl-2-[methyl(undecyl)amino]butanoic acid is sourced from PubChem (CID 154125332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).