C18H31N — CID 63491055
2,6-diethyl-N-octylaniline (PubChem CID 63491055) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 2,6-diethyl-N-octylaniline.
| Compound Name | 2,6-diethyl-N-octylaniline |
|---|---|
| PubChem CID | 63491055 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 2,6-diethyl-N-octylaniline |
| SMILES | CCCCCCCCNc1c(CC)cccc1CC |
| InChI | InChI=1S/C18H31N/c1-4-7-8-9-10-11-15-19-18-16(5-2)13-12-14-17(18)6-3/h12-14,19H,4-11,15H2,1-3H3 |
| InChIKey | XWDHJNUHQNCVHD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|