C14H23NO — CID 62327687
4-(2,6-diethylanilino)butan-1-ol (PubChem CID 62327687) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 4-(2,6-diethylanilino)butan-1-ol.
| Compound Name | 4-(2,6-diethylanilino)butan-1-ol |
|---|---|
| PubChem CID | 62327687 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 4-(2,6-diethylanilino)butan-1-ol |
| SMILES | CCc1cccc(CC)c1NCCCCO |
| InChI | InChI=1S/C14H23NO/c1-3-12-8-7-9-13(4-2)14(12)15-10-5-6-11-16/h7-9,15-16H,3-6,10-11H2,1-2H3 |
| InChIKey | QURGGRAMAGUQCL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|