C13H18NNaO2 — CID 21362135
sodium 5-(2,6-dimethylanilino)pentanoate (PubChem CID 21362135) has the molecular formula C13H18NNaO2 and a molecular weight of 243.28 g/mol. Its IUPAC name is sodium 5-(2,6-dimethylanilino)pentanoate.
| Compound Name | sodium 5-(2,6-dimethylanilino)pentanoate |
|---|---|
| PubChem CID | 21362135 |
| Molecular Formula | C13H18NNaO2 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | sodium 5-(2,6-dimethylanilino)pentanoate |
| SMILES | Cc1cccc(C)c1NCCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H19NO2.Na/c1-10-6-5-7-11(2)13(10)14-9-4-3-8-12(15)16;/h5-7,14H,3-4,8-9H2,1-2H3,(H,15,16);/q;+1/p-1 |
| InChIKey | UPLHMDIKQGYTNO-UHFFFAOYSA-M |
| XLogP | -1.36 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|