C14H23N — CID 83156860
2,6-dimethyl-N-(4-methylpentyl)aniline (PubChem CID 83156860) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 2,6-dimethyl-N-(4-methylpentyl)aniline.
| Compound Name | 2,6-dimethyl-N-(4-methylpentyl)aniline |
|---|---|
| PubChem CID | 83156860 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 2,6-dimethyl-N-(4-methylpentyl)aniline |
| SMILES | Cc1cccc(C)c1NCCCC(C)C |
| InChI | InChI=1S/C14H23N/c1-11(2)7-6-10-15-14-12(3)8-5-9-13(14)4/h5,8-9,11,15H,6-7,10H2,1-4H3 |
| InChIKey | LTANGNBWOZBMSV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|