C13H20N2S — CID 107107719
3-methyl-2-(3-methylbutylamino)benzenecarbothioamide (PubChem CID 107107719) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 3-methyl-2-(3-methylbutylamino)benzenecarbothioamide.
| Compound Name | 3-methyl-2-(3-methylbutylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107107719 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3-methyl-2-(3-methylbutylamino)benzenecarbothioamide |
| SMILES | Cc1cccc(C(N)=S)c1NCCC(C)C |
| InChI | InChI=1S/C13H20N2S/c1-9(2)7-8-15-12-10(3)5-4-6-11(12)13(14)16/h4-6,9,15H,7-8H2,1-3H3,(H2,14,16) |
| InChIKey | BFPNDVSCUBAGBW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|