C27H33NO4 — CID 11604503
1-[4,4-bis(4-methoxyphenyl)butylamino]-3-phenoxypropan-2-ol (PubChem CID 11604503) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is 1-[4,4-bis(4-methoxyphenyl)butylamino]-3-phenoxypropan-2-ol.
| Compound Name | 1-[4,4-bis(4-methoxyphenyl)butylamino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 11604503 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 1-[4,4-bis(4-methoxyphenyl)butylamino]-3-phenoxypropan-2-ol |
| SMILES | COc1ccc(C(CCCNCC(O)COc2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H33NO4/c1-30-24-14-10-21(11-15-24)27(22-12-16-25(31-2)17-13-22)9-6-18-28-19-23(29)20-32-26-7-4-3-5-8-26/h3-5,7-8,10-17,23,27-29H,6,9,18-20H2,1-2H3 |
| InChIKey | FEUAINIODMHATB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|