C28H33NO8 — CID 110194018
1-(3-benzhydryloxypropylamino)-3-(4-methoxyphenoxy)propan-2-ol;oxalic acid (PubChem CID 110194018) has the molecular formula C28H33NO8 and a molecular weight of 511.57 g/mol. Its IUPAC name is 1-(3-benzhydryloxypropylamino)-3-(4-methoxyphenoxy)propan-2-ol;oxalic acid.
| Compound Name | 1-(3-benzhydryloxypropylamino)-3-(4-methoxyphenoxy)propan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 110194018 |
| Molecular Formula | C28H33NO8 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 1-(3-benzhydryloxypropylamino)-3-(4-methoxyphenoxy)propan-2-ol;oxalic acid |
| SMILES | COc1ccc(OCC(O)CNCCCOC(c2ccccc2)c2ccccc2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H31NO4.C2H2O4/c1-29-24-13-15-25(16-14-24)31-20-23(28)19-27-17-8-18-30-26(21-9-4-2-5-10-21)22-11-6-3-7-12-22;3-1(4)2(5)6/h2-7,9-16,23,26-28H,8,17-20H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | KJMUAEBISSRAII-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|