C56H66N6O16S-2 — CID 10213827
bis(methyl N-[4-[3-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-1-[4-(methoxycarbonylamino)phenyl]propyl]phenyl]carbamate);sulfate (PubChem CID 10213827) has the molecular formula C56H66N6O16S-2 and a molecular weight of 1111.24 g/mol. Its IUPAC name is bis(methyl N-[4-[3-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-1-[4-(methoxycarbonylamino)phenyl]propyl]phenyl]carbamate);sulfate.
| Compound Name | bis(methyl N-[4-[3-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-1-[4-(methoxycarbonylamino)phenyl]propyl]phenyl]carbamate);sulfate |
|---|---|
| PubChem CID | 10213827 |
| Molecular Formula | C56H66N6O16S-2 |
| Molecular Weight | 1111.24 g/mol |
| Exact Mass | 1110.43 |
| IUPAC Name | bis(methyl N-[4-[3-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-1-[4-(methoxycarbonylamino)phenyl]propyl]phenyl]carbamate);sulfate |
| SMILES | COC(=O)Nc1ccc(C(CCNC[C@H](O)COc2ccccc2)c2ccc(NC(=O)OC)cc2)cc1.COC(=O)Nc1ccc(C(CCNC[C@H](O)COc2ccccc2)c2ccc(NC(=O)OC)cc2)cc1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C28H33N3O6.H2O4S/c2*1-35-27(33)30-22-12-8-20(9-13-22)26(21-10-14-23(15-11-21)31-28(34)36-2)16-17-29-18-24(32)19-37-25-6-4-3-5-7-25;1-5(2,3)4/h2*3-15,24,26,29,32H,16-19H2,1-2H3,(H,30,33)(H,31,34);(H2,1,2,3,4)/p-2/t2*24-;/m00./s1 |
| InChIKey | JKKYIJPOGHHGBD-YPPDDXJESA-L |
| XLogP | 7.85 |
| TPSA | 316.56 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 79 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1111.24 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|