C17H26N4O3 — CID 12818856
5-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethylamino]-1,2,4-trimethylpyrazol-3-one (PubChem CID 12818856) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 5-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethylamino]-1,2,4-trimethylpyrazol-3-one.
| Compound Name | 5-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethylamino]-1,2,4-trimethylpyrazol-3-one |
|---|---|
| PubChem CID | 12818856 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 5-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethylamino]-1,2,4-trimethylpyrazol-3-one |
| SMILES | Cc1c(NCCNCC(O)COc2ccccc2)n(C)n(C)c1=O |
| InChI | InChI=1S/C17H26N4O3/c1-13-16(20(2)21(3)17(13)23)19-10-9-18-11-14(22)12-24-15-7-5-4-6-8-15/h4-8,14,18-19,22H,9-12H2,1-3H3 |
| InChIKey | LXCVVXPIMPRLOT-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 80.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|