C36H50N8O8 — CID 70454204
bis[1-phenoxy-3-[2-[(1,2,4-trimethyl-5-oxopyrazol-3-yl)amino]ethylamino]propan-2-yl] oxalate (PubChem CID 70454204) has the molecular formula C36H50N8O8 and a molecular weight of 722.84 g/mol. Its IUPAC name is bis[1-phenoxy-3-[2-[(1,2,4-trimethyl-5-oxopyrazol-3-yl)amino]ethylamino]propan-2-yl] oxalate.
| Compound Name | bis[1-phenoxy-3-[2-[(1,2,4-trimethyl-5-oxopyrazol-3-yl)amino]ethylamino]propan-2-yl] oxalate |
|---|---|
| PubChem CID | 70454204 |
| Molecular Formula | C36H50N8O8 |
| Molecular Weight | 722.84 g/mol |
| Exact Mass | 722.38 |
| IUPAC Name | bis[1-phenoxy-3-[2-[(1,2,4-trimethyl-5-oxopyrazol-3-yl)amino]ethylamino]propan-2-yl] oxalate |
| SMILES | Cc1c(NCCNCC(COc2ccccc2)OC(=O)C(=O)OC(CNCCNc2c(C)c(=O)n(C)n2C)COc2ccccc2)n(C)n(C)c1=O |
| InChI | InChI=1S/C36H50N8O8/c1-25-31(41(3)43(5)33(25)45)39-19-17-37-21-29(23-49-27-13-9-7-10-14-27)51-35(47)36(48)52-30(24-50-28-15-11-8-12-16-28)22-38-18-20-40-32-26(2)34(46)44(6)42(32)4/h7-16,29-30,37-40H,17-24H2,1-6H3 |
| InChIKey | OSALVUOFVTWEIA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 173.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.84 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|