C18H26N4O2 — CID 12818857
1-phenoxy-3-[2-[(2,5,6-trimethylpyrimidin-4-yl)amino]ethylamino]propan-2-ol (PubChem CID 12818857) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-phenoxy-3-[2-[(2,5,6-trimethylpyrimidin-4-yl)amino]ethylamino]propan-2-ol.
| Compound Name | 1-phenoxy-3-[2-[(2,5,6-trimethylpyrimidin-4-yl)amino]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 12818857 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1-phenoxy-3-[2-[(2,5,6-trimethylpyrimidin-4-yl)amino]ethylamino]propan-2-ol |
| SMILES | Cc1nc(C)c(C)c(NCCNCC(O)COc2ccccc2)n1 |
| InChI | InChI=1S/C18H26N4O2/c1-13-14(2)21-15(3)22-18(13)20-10-9-19-11-16(23)12-24-17-7-5-4-6-8-17/h4-8,16,19,23H,9-12H2,1-3H3,(H,20,21,22) |
| InChIKey | SDVKDQYRGRHOTG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|