C17H20Cl2N2O2 — CID 3054449
1-[2-(2,6-dichloroanilino)ethylamino]-3-phenoxypropan-2-ol (PubChem CID 3054449) has the molecular formula C17H20Cl2N2O2 and a molecular weight of 355.26 g/mol. Its IUPAC name is 1-[2-(2,6-dichloroanilino)ethylamino]-3-phenoxypropan-2-ol.
| Compound Name | 1-[2-(2,6-dichloroanilino)ethylamino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 3054449 |
| Molecular Formula | C17H20Cl2N2O2 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-[2-(2,6-dichloroanilino)ethylamino]-3-phenoxypropan-2-ol |
| SMILES | OC(CNCCNc1c(Cl)cccc1Cl)COc1ccccc1 |
| InChI | InChI=1S/C17H20Cl2N2O2/c18-15-7-4-8-16(19)17(15)21-10-9-20-11-13(22)12-23-14-5-2-1-3-6-14/h1-8,13,20-22H,9-12H2 |
| InChIKey | FNUUCCYETJKAGB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|