C18H26N4O4 — CID 12818859
6-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethylamino]-1,3,5-trimethylpyrimidine-2,4-dione (PubChem CID 12818859) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 6-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethylamino]-1,3,5-trimethylpyrimidine-2,4-dione.
| Compound Name | 6-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethylamino]-1,3,5-trimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 12818859 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 6-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethylamino]-1,3,5-trimethylpyrimidine-2,4-dione |
| SMILES | Cc1c(NCCNCC(O)COc2ccccc2)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C18H26N4O4/c1-13-16(21(2)18(25)22(3)17(13)24)20-10-9-19-11-14(23)12-26-15-7-5-4-6-8-15/h4-8,14,19-20,23H,9-12H2,1-3H3 |
| InChIKey | OOOFIYIJUCEZER-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|