C22H34N4O5 — CID 23349133
6-[2-[[2-hydroxy-3-(4-pentoxyphenoxy)propyl]amino]ethylamino]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 23349133) has the molecular formula C22H34N4O5 and a molecular weight of 434.54 g/mol. Its IUPAC name is 6-[2-[[2-hydroxy-3-(4-pentoxyphenoxy)propyl]amino]ethylamino]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-[2-[[2-hydroxy-3-(4-pentoxyphenoxy)propyl]amino]ethylamino]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23349133 |
| Molecular Formula | C22H34N4O5 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 6-[2-[[2-hydroxy-3-(4-pentoxyphenoxy)propyl]amino]ethylamino]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | CCCCCOc1ccc(OCC(O)CNCCNc2cc(=O)n(C)c(=O)n2C)cc1 |
| InChI | InChI=1S/C22H34N4O5/c1-4-5-6-13-30-18-7-9-19(10-8-18)31-16-17(27)15-23-11-12-24-20-14-21(28)26(3)22(29)25(20)2/h7-10,14,17,23-24,27H,4-6,11-13,15-16H2,1-3H3 |
| InChIKey | XQFLJOWNNQSOOP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 106.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|