C25H37N5O5 — CID 54508381
7-[3-[[3-(2-hexoxyphenoxy)-2-hydroxypropyl]amino]propyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 54508381) has the molecular formula C25H37N5O5 and a molecular weight of 487.60 g/mol. Its IUPAC name is 7-[3-[[3-(2-hexoxyphenoxy)-2-hydroxypropyl]amino]propyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[3-[[3-(2-hexoxyphenoxy)-2-hydroxypropyl]amino]propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 54508381 |
| Molecular Formula | C25H37N5O5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | 7-[3-[[3-(2-hexoxyphenoxy)-2-hydroxypropyl]amino]propyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CCCCCCOc1ccccc1OCC(O)CNCCCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C25H37N5O5/c1-4-5-6-9-15-34-20-11-7-8-12-21(20)35-17-19(31)16-26-13-10-14-30-18-27-23-22(30)24(32)29(3)25(33)28(23)2/h7-8,11-12,18-19,26,31H,4-6,9-10,13-17H2,1-3H3 |
| InChIKey | YHIWKGNDNWZKCT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|