C23H31N5O6 — CID 54441453
[2-[3-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propylamino]-2-hydroxypropoxy]phenyl] butanoate (PubChem CID 54441453) has the molecular formula C23H31N5O6 and a molecular weight of 473.53 g/mol. Its IUPAC name is [2-[3-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propylamino]-2-hydroxypropoxy]phenyl] butanoate.
| Compound Name | [2-[3-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propylamino]-2-hydroxypropoxy]phenyl] butanoate |
|---|---|
| PubChem CID | 54441453 |
| Molecular Formula | C23H31N5O6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | [2-[3-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propylamino]-2-hydroxypropoxy]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccccc1OCC(O)CNCCCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C23H31N5O6/c1-4-8-19(30)34-18-10-6-5-9-17(18)33-14-16(29)13-24-11-7-12-28-15-25-21-20(28)22(31)27(3)23(32)26(21)2/h5-6,9-10,15-16,24,29H,4,7-8,11-14H2,1-3H3 |
| InChIKey | WOJUNGJEUDGFAQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|