C22H30N6O5 — CID 110180994
N-[4-[3-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butylamino]-2-hydroxypropoxy]phenyl]acetamide (PubChem CID 110180994) has the molecular formula C22H30N6O5 and a molecular weight of 458.52 g/mol. Its IUPAC name is N-[4-[3-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butylamino]-2-hydroxypropoxy]phenyl]acetamide.
| Compound Name | N-[4-[3-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butylamino]-2-hydroxypropoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 110180994 |
| Molecular Formula | C22H30N6O5 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | N-[4-[3-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butylamino]-2-hydroxypropoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(OCC(O)CNCCCCn2cnc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C22H30N6O5/c1-15(29)25-16-6-8-18(9-7-16)33-13-17(30)12-23-10-4-5-11-28-14-24-20-19(28)21(31)27(3)22(32)26(20)2/h6-9,14,17,23,30H,4-5,10-13H2,1-3H3,(H,25,29) |
| InChIKey | WQAZOCXQHHDKJF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 132.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|