C22H31ClN6O5 — CID 110180993
[3-(4-acetamidophenoxy)-2-hydroxypropyl]-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butyl]azanium chloride (PubChem CID 110180993) has the molecular formula C22H31ClN6O5 and a molecular weight of 494.98 g/mol. Its IUPAC name is [3-(4-acetamidophenoxy)-2-hydroxypropyl]-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butyl]azanium chloride.
| Compound Name | [3-(4-acetamidophenoxy)-2-hydroxypropyl]-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butyl]azanium chloride |
|---|---|
| PubChem CID | 110180993 |
| Molecular Formula | C22H31ClN6O5 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | [3-(4-acetamidophenoxy)-2-hydroxypropyl]-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butyl]azanium chloride |
| SMILES | CC(=O)Nc1ccc(OCC(O)C[NH2+]CCCCn2cnc3c2c(=O)n(C)c(=O)n3C)cc1.[Cl-] |
| InChI | InChI=1S/C22H30N6O5.ClH/c1-15(29)25-16-6-8-18(9-7-16)33-13-17(30)12-23-10-4-5-11-28-14-24-20-19(28)21(31)27(3)22(32)26(20)2;/h6-9,14,17,23,30H,4-5,10-13H2,1-3H3,(H,25,29);1H |
| InChIKey | JGFCWXWTTTXHPC-UHFFFAOYSA-N |
| XLogP | -3.82 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|