C20H28ClN5O3 — CID 110175147
4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butyl-[1-(4-hydroxyphenyl)propan-2-yl]azanium chloride (PubChem CID 110175147) has the molecular formula C20H28ClN5O3 and a molecular weight of 421.93 g/mol. Its IUPAC name is 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butyl-[1-(4-hydroxyphenyl)propan-2-yl]azanium chloride.
| Compound Name | 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butyl-[1-(4-hydroxyphenyl)propan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 110175147 |
| Molecular Formula | C20H28ClN5O3 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butyl-[1-(4-hydroxyphenyl)propan-2-yl]azanium chloride |
| SMILES | CC(Cc1ccc(O)cc1)[NH2+]CCCCn1cnc2c1c(=O)n(C)c(=O)n2C.[Cl-] |
| InChI | InChI=1S/C20H27N5O3.ClH/c1-14(12-15-6-8-16(26)9-7-15)21-10-4-5-11-25-13-22-18-17(25)19(27)24(3)20(28)23(18)2;/h6-9,13-14,21,26H,4-5,10-12H2,1-3H3;1H |
| InChIKey | NVFVRAPCZWDEBU-UHFFFAOYSA-N |
| XLogP | -2.88 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|