C19H32ClN5O3 — CID 110183452
(1-cyclohexyl-1-hydroxypropan-2-yl)-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl]azanium chloride (PubChem CID 110183452) has the molecular formula C19H32ClN5O3 and a molecular weight of 413.95 g/mol. Its IUPAC name is (1-cyclohexyl-1-hydroxypropan-2-yl)-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl]azanium chloride.
| Compound Name | (1-cyclohexyl-1-hydroxypropan-2-yl)-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl]azanium chloride |
|---|---|
| PubChem CID | 110183452 |
| Molecular Formula | C19H32ClN5O3 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (1-cyclohexyl-1-hydroxypropan-2-yl)-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propyl]azanium chloride |
| SMILES | CC([NH2+]CCCn1cnc2c1c(=O)n(C)c(=O)n2C)C(O)C1CCCCC1.[Cl-] |
| InChI | InChI=1S/C19H31N5O3.ClH/c1-13(16(25)14-8-5-4-6-9-14)20-10-7-11-24-12-21-17-15(24)18(26)23(3)19(27)22(17)2;/h12-14,16,20,25H,4-11H2,1-3H3;1H |
| InChIKey | MVUAQYPRKYPECM-UHFFFAOYSA-N |
| XLogP | -3.28 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|