C25H35N5O4 — CID 70605850
7-[3-[[3-(3-cyclohexylphenoxy)-2-hydroxypropyl]amino]propyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 70605850) has the molecular formula C25H35N5O4 and a molecular weight of 469.59 g/mol. Its IUPAC name is 7-[3-[[3-(3-cyclohexylphenoxy)-2-hydroxypropyl]amino]propyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[3-[[3-(3-cyclohexylphenoxy)-2-hydroxypropyl]amino]propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 70605850 |
| Molecular Formula | C25H35N5O4 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 7-[3-[[3-(3-cyclohexylphenoxy)-2-hydroxypropyl]amino]propyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCCNCC(O)COc2cccc(C3CCCCC3)c2)n(C)c1=O |
| InChI | InChI=1S/C25H35N5O4/c1-28-23-22(24(32)29(2)25(28)33)30(17-27-23)13-7-12-26-15-20(31)16-34-21-11-6-10-19(14-21)18-8-4-3-5-9-18/h6,10-11,14,17-18,20,26,31H,3-5,7-9,12-13,15-16H2,1-2H3 |
| InChIKey | YOYMISJLUXBHCW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|