C19H27N7O9 — CID 54442045
[6-[3-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propylamino]-2-hydroxypropoxy]imino-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] nitrate (PubChem CID 54442045) has the molecular formula C19H27N7O9 and a molecular weight of 497.47 g/mol. Its IUPAC name is [6-[3-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propylamino]-2-hydroxypropoxy]imino-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] nitrate.
| Compound Name | [6-[3-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propylamino]-2-hydroxypropoxy]imino-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] nitrate |
|---|---|
| PubChem CID | 54442045 |
| Molecular Formula | C19H27N7O9 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | [6-[3-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propylamino]-2-hydroxypropoxy]imino-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] nitrate |
| SMILES | Cn1c(=O)c2c(ncn2CCCNCC(O)CON=C2COC3C(O[N+](=O)[O-])COC23)n(C)c1=O |
| InChI | InChI=1S/C19H27N7O9/c1-23-17-14(18(28)24(2)19(23)29)25(10-21-17)5-3-4-20-6-11(27)7-34-22-12-8-32-16-13(35-26(30)31)9-33-15(12)16/h10-11,13,15-16,20,27H,3-9H2,1-2H3 |
| InChIKey | WOUMQHOAWFPUBY-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|