C18H27N5O7 — CID 70380317
7-[2-[[3-[(3R,3aR,6S,6aR)-3,6-dihydroxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]-2-hydroxypropyl]amino]ethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 70380317) has the molecular formula C18H27N5O7 and a molecular weight of 425.44 g/mol. Its IUPAC name is 7-[2-[[3-[(3R,3aR,6S,6aR)-3,6-dihydroxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]-2-hydroxypropyl]amino]ethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[2-[[3-[(3R,3aR,6S,6aR)-3,6-dihydroxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]-2-hydroxypropyl]amino]ethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 70380317 |
| Molecular Formula | C18H27N5O7 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 7-[2-[[3-[(3R,3aR,6S,6aR)-3,6-dihydroxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]-2-hydroxypropyl]amino]ethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCNCC(O)C[C@]23OC[C@@H](O)[C@H]2OC[C@@H]3O)n(C)c1=O |
| InChI | InChI=1S/C18H27N5O7/c1-21-15-13(16(27)22(2)17(21)28)23(9-20-15)4-3-19-6-10(24)5-18-12(26)8-29-14(18)11(25)7-30-18/h9-12,14,19,24-26H,3-8H2,1-2H3/t10?,11-,12+,14-,18-/m1/s1 |
| InChIKey | XJWYSNMTUYJUSZ-CGKHEHTGSA-N |
| XLogP | -3.34 |
| TPSA | 153.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|