C23H33N5O4 — CID 110176673
7-[2-[[2-hydroxy-2-[4-hydroxy-3,5-di(propan-2-yl)phenyl]ethyl]amino]ethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 110176673) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is 7-[2-[[2-hydroxy-2-[4-hydroxy-3,5-di(propan-2-yl)phenyl]ethyl]amino]ethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[2-[[2-hydroxy-2-[4-hydroxy-3,5-di(propan-2-yl)phenyl]ethyl]amino]ethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 110176673 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 7-[2-[[2-hydroxy-2-[4-hydroxy-3,5-di(propan-2-yl)phenyl]ethyl]amino]ethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CC(C)c1cc(C(O)CNCCn2cnc3c2c(=O)n(C)c(=O)n3C)cc(C(C)C)c1O |
| InChI | InChI=1S/C23H33N5O4/c1-13(2)16-9-15(10-17(14(3)4)20(16)30)18(29)11-24-7-8-28-12-25-21-19(28)22(31)27(6)23(32)26(21)5/h9-10,12-14,18,24,29-30H,7-8,11H2,1-6H3 |
| InChIKey | BNQRVMWGZCGIEX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 114.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|