C18H26N6O9 — CID 22839654
[(3S,3aS,6R,6aS)-6-[3-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylamino]-2-hydroxypropyl]-6-hydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] nitrate (PubChem CID 22839654) has the molecular formula C18H26N6O9 and a molecular weight of 470.44 g/mol. Its IUPAC name is [(3S,3aS,6R,6aS)-6-[3-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylamino]-2-hydroxypropyl]-6-hydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] nitrate.
| Compound Name | [(3S,3aS,6R,6aS)-6-[3-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylamino]-2-hydroxypropyl]-6-hydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] nitrate |
|---|---|
| PubChem CID | 22839654 |
| Molecular Formula | C18H26N6O9 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | [(3S,3aS,6R,6aS)-6-[3-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylamino]-2-hydroxypropyl]-6-hydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] nitrate |
| SMILES | Cn1c(=O)c2c(ncn2CCNCC(O)C[C@@]2(O)CO[C@@H]3[C@@H](O[N+](=O)[O-])CO[C@@H]32)n(C)c1=O |
| InChI | InChI=1S/C18H26N6O9/c1-21-15-12(16(26)22(2)17(21)27)23(9-20-15)4-3-19-6-10(25)5-18(28)8-32-13-11(33-24(29)30)7-31-14(13)18/h9-11,13-14,19,25,28H,3-8H2,1-2H3/t10?,11-,13+,14-,18+/m0/s1 |
| InChIKey | MCBUTNXSGLKQQC-KOFNTXMLSA-N |
| XLogP | -3.12 |
| TPSA | 185.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|