C16H22N6O7 — CID 10001589
[(3R)-3-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate (PubChem CID 10001589) has the molecular formula C16H22N6O7 and a molecular weight of 410.39 g/mol. Its IUPAC name is [(3R)-3-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate.
| Compound Name | [(3R)-3-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
|---|---|
| PubChem CID | 10001589 |
| Molecular Formula | C16H22N6O7 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [(3R)-3-[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
| SMILES | Cn1c(=O)c2c(ncn2CCCN[C@@H]2COC3C(O[N+](=O)[O-])COC32)n(C)c1=O |
| InChI | InChI=1S/C16H22N6O7/c1-19-14-11(15(23)20(2)16(19)24)21(8-18-14)5-3-4-17-9-6-27-13-10(29-22(25)26)7-28-12(9)13/h8-10,12-13,17H,3-7H2,1-2H3/t9-,10?,12?,13?/m1/s1 |
| InChIKey | XTEGRRHNMFDROI-QMDOVSTPSA-N |
| XLogP | -1.84 |
| TPSA | 144.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|