C16H20N6O9 — CID 57296778
[6-[[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-hydroxypropoxy]amino]-2,3,3a,5-tetrahydrofuro[3,2-b]furan-3-yl] nitrate (PubChem CID 57296778) has the molecular formula C16H20N6O9 and a molecular weight of 440.37 g/mol. Its IUPAC name is [6-[[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-hydroxypropoxy]amino]-2,3,3a,5-tetrahydrofuro[3,2-b]furan-3-yl] nitrate.
| Compound Name | [6-[[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-hydroxypropoxy]amino]-2,3,3a,5-tetrahydrofuro[3,2-b]furan-3-yl] nitrate |
|---|---|
| PubChem CID | 57296778 |
| Molecular Formula | C16H20N6O9 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | [6-[[3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-hydroxypropoxy]amino]-2,3,3a,5-tetrahydrofuro[3,2-b]furan-3-yl] nitrate |
| SMILES | Cn1c(=O)c2c(ncn2CC(O)CONC2=C3OCC(O[N+](=O)[O-])C3OC2)n(C)c1=O |
| InChI | InChI=1S/C16H20N6O9/c1-19-14-11(15(24)20(2)16(19)25)21(7-17-14)3-8(23)4-30-18-9-5-28-13-10(31-22(26)27)6-29-12(9)13/h7-8,10,13,18,23H,3-6H2,1-2H3 |
| InChIKey | IINIRVBUFFCIMS-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 174.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|