C20H29N5O2 — CID 110180441
7-[3-(1-adamantylamino)propyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 110180441) has the molecular formula C20H29N5O2 and a molecular weight of 371.49 g/mol. Its IUPAC name is 7-[3-(1-adamantylamino)propyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[3-(1-adamantylamino)propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 110180441 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 7-[3-(1-adamantylamino)propyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCCNC23CC4CC(CC(C4)C2)C3)n(C)c1=O |
| InChI | InChI=1S/C20H29N5O2/c1-23-17-16(18(26)24(2)19(23)27)25(12-21-17)5-3-4-22-20-9-13-6-14(10-20)8-15(7-13)11-20/h12-15,22H,3-11H2,1-2H3 |
| InChIKey | UDZLEKABEYLQLC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|